C30H33NO3 — CID 166451315
N-[4-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]phenyl]octanamide (PubChem CID 166451315) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[4-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]phenyl]octanamide.
| Compound Name | N-[4-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]phenyl]octanamide |
|---|---|
| PubChem CID | 166451315 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N-[4-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(C(=O)/C=C/c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H33NO3/c1-2-3-4-5-9-12-30(33)31-27-18-16-26(17-19-27)29(32)22-15-24-13-20-28(21-14-24)34-23-25-10-7-6-8-11-25/h6-8,10-11,13-22H,2-5,9,12,23H2,1H3,(H,31,33)/b22-15+ |
| InChIKey | TUOKNDVQBLAWET-PXLXIMEGSA-N |
| XLogP | 7.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|