C29H29NO4 — CID 19175163
cyclohexyl 4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19175163) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is cyclohexyl 4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19175163 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | cyclohexyl 4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)cc1)Nc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C29H29NO4/c31-28(20-13-22-11-18-26(19-12-22)33-21-23-7-3-1-4-8-23)30-25-16-14-24(15-17-25)29(32)34-27-9-5-2-6-10-27/h1,3-4,7-8,11-20,27H,2,5-6,9-10,21H2,(H,30,31)/b20-13+ |
| InChIKey | FYUQPZVOCKUPQS-DEDYPNTBSA-N |
| XLogP | 6.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|