C25H24N2O4 — CID 60578500
methyl N-methyl-N-[4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]carbamate (PubChem CID 60578500) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl N-methyl-N-[4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]carbamate.
| Compound Name | methyl N-methyl-N-[4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 60578500 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl N-methyl-N-[4-[[(E)-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]carbamate |
| SMILES | COC(=O)N(C)c1ccc(NC(=O)/C=C/c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-27(25(29)30-2)22-13-11-21(12-14-22)26-24(28)17-10-19-8-15-23(16-9-19)31-18-20-6-4-3-5-7-20/h3-17H,18H2,1-2H3,(H,26,28)/b17-10+ |
| InChIKey | OLGNHAKGOXZAIU-LICLKQGHSA-N |
| XLogP | 5.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|