C24H24N2O2 — CID 134154267
(E)-N-[4-[[benzyl(methyl)amino]methyl]phenyl]-3-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 134154267) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-N-[4-[[benzyl(methyl)amino]methyl]phenyl]-3-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[benzyl(methyl)amino]methyl]phenyl]-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 134154267 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (E)-N-[4-[[benzyl(methyl)amino]methyl]phenyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CN(Cc1ccccc1)Cc1ccc(NC(=O)/C=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-26(17-20-5-3-2-4-6-20)18-21-7-12-22(13-8-21)25-24(28)16-11-19-9-14-23(27)15-10-19/h2-16,27H,17-18H2,1H3,(H,25,28)/b16-11+ |
| InChIKey | HCRUXWJAWJFAGF-LFIBNONCSA-N |
| XLogP | 4.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|