C18H17FN2O3 — CID 60578498
methyl N-[4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]phenyl]-N-methylcarbamate (PubChem CID 60578498) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is methyl N-[4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]phenyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 60578498 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl N-[4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]phenyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1ccc(NC(=O)/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-21(18(23)24-2)16-9-7-15(8-10-16)20-17(22)11-6-13-4-3-5-14(19)12-13/h3-12H,1-2H3,(H,20,22)/b11-6+ |
| InChIKey | OERSWUGGRLAKLJ-IZZDOVSWSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|