C16H14ClNO3S — CID 42994544
(E)-3-(3-chlorophenyl)-N-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 42994544) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42994544 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)/C=C/c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H14ClNO3S/c1-22(20,21)15-8-6-14(7-9-15)18-16(19)10-5-12-3-2-4-13(17)11-12/h2-11H,1H3,(H,18,19)/b10-5+ |
| InChIKey | UCVRTVGFWBDOFN-BJMVGYQFSA-N |
| XLogP | 3.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|