C17H14ClN5O3S — CID 74954141
3-(3-chlorophenyl)-N-[4-(1H-1,2,4-triazol-5-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 74954141) has the molecular formula C17H14ClN5O3S and a molecular weight of 403.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[4-(1H-1,2,4-triazol-5-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-[4-(1H-1,2,4-triazol-5-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 74954141 |
| Molecular Formula | C17H14ClN5O3S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[4-(1H-1,2,4-triazol-5-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1)Nc1ccc(S(=O)(=O)Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C17H14ClN5O3S/c18-13-3-1-2-12(10-13)4-9-16(24)21-14-5-7-15(8-6-14)27(25,26)23-17-19-11-20-22-17/h1-11H,(H,21,24)(H2,19,20,22,23) |
| InChIKey | HLVRNUSLNDVGRC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|