C21H16BrClN2O3S — CID 6179194
(E)-N-[3-[(4-bromophenyl)sulfamoyl]phenyl]-3-(3-chlorophenyl)prop-2-enamide (PubChem CID 6179194) has the molecular formula C21H16BrClN2O3S and a molecular weight of 491.79 g/mol. Its IUPAC name is (E)-N-[3-[(4-bromophenyl)sulfamoyl]phenyl]-3-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[(4-bromophenyl)sulfamoyl]phenyl]-3-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6179194 |
| Molecular Formula | C21H16BrClN2O3S |
| Molecular Weight | 491.79 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | (E)-N-[3-[(4-bromophenyl)sulfamoyl]phenyl]-3-(3-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)Nc1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H16BrClN2O3S/c22-16-8-10-18(11-9-16)25-29(27,28)20-6-2-5-19(14-20)24-21(26)12-7-15-3-1-4-17(23)13-15/h1-14,25H,(H,24,26)/b12-7+ |
| InChIKey | FRAAVLIBOXJXGK-KPKJPENVSA-N |
| XLogP | 5.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.79 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|