C22H26ClN3O5S — CID 97435406
tert-butyl N-[2-[[3-[[(Z)-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 97435406) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[[(Z)-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[[(Z)-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 97435406 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | tert-butyl N-[2-[[3-[[(Z)-3-(3-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1cccc(NC(=O)/C=C\c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H26ClN3O5S/c1-22(2,3)31-21(28)24-12-13-25-32(29,30)19-9-5-8-18(15-19)26-20(27)11-10-16-6-4-7-17(23)14-16/h4-11,14-15,25H,12-13H2,1-3H3,(H,24,28)(H,26,27)/b11-10- |
| InChIKey | XYOMARFGVXYZAO-KHPPLWFESA-N |
| XLogP | 3.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|