C18H29N3O6S — CID 56502577
tert-butyl N-[2-[[3-(3-ethoxypropanoylamino)phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 56502577) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(3-ethoxypropanoylamino)phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(3-ethoxypropanoylamino)phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 56502577 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | tert-butyl N-[2-[[3-(3-ethoxypropanoylamino)phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CCOCCC(=O)Nc1cccc(S(=O)(=O)NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H29N3O6S/c1-5-26-12-9-16(22)21-14-7-6-8-15(13-14)28(24,25)20-11-10-19-17(23)27-18(2,3)4/h6-8,13,20H,5,9-12H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | QZJXZHBCABWBKJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|