C13H19FN2O4S — CID 164548562
tert-butyl N-[2-[(3-fluorophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 164548562) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-fluorophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-fluorophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 164548562 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | tert-butyl N-[2-[(3-fluorophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H19FN2O4S/c1-13(2,3)20-12(17)15-7-8-16-21(18,19)11-6-4-5-10(14)9-11/h4-6,9,16H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | UOIQUOYEILXYPW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|