C13H20FN3O4S — CID 104932760
tert-butyl N-[2-[(2-amino-5-fluorophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 104932760) has the molecular formula C13H20FN3O4S and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-amino-5-fluorophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-amino-5-fluorophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 104932760 |
| Molecular Formula | C13H20FN3O4S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | tert-butyl N-[2-[(2-amino-5-fluorophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C13H20FN3O4S/c1-13(2,3)21-12(18)16-6-7-17-22(19,20)11-8-9(14)4-5-10(11)15/h4-5,8,17H,6-7,15H2,1-3H3,(H,16,18) |
| InChIKey | MTUHSJSMFNYJDB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|