C23H26FN5O4S — CID 90326401
tert-butyl N-[2-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 90326401) has the molecular formula C23H26FN5O4S and a molecular weight of 487.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 90326401 |
| Molecular Formula | C23H26FN5O4S |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | tert-butyl N-[2-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1 |
| InChI | InChI=1S/C23H26FN5O4S/c1-23(2,3)33-22(30)26-10-11-29-34(31,32)20-7-5-4-6-16(20)15-8-9-17(18(24)12-15)19-13-28-21(25)14-27-19/h4-9,12-14,29H,10-11H2,1-3H3,(H2,25,28)(H,26,30) |
| InChIKey | BXRXHDPTIPNNOX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|