C14H20N4O4S — CID 104932801
tert-butyl N-[2-[(2-amino-4-cyanophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 104932801) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-amino-4-cyanophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-amino-4-cyanophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 104932801 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | tert-butyl N-[2-[(2-amino-4-cyanophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C14H20N4O4S/c1-14(2,3)22-13(19)17-6-7-18-23(20,21)12-5-4-10(9-15)8-11(12)16/h4-5,8,18H,6-7,16H2,1-3H3,(H,17,19) |
| InChIKey | RCWQVCBGQZBWLY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|