C15H21N3O3 — CID 130270700
tert-butyl N-[3-(2-amino-4-cyanophenoxy)propyl]carbamate (PubChem CID 130270700) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[3-(2-amino-4-cyanophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-amino-4-cyanophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 130270700 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-[3-(2-amino-4-cyanophenoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(C#N)cc1N |
| InChI | InChI=1S/C15H21N3O3/c1-15(2,3)21-14(19)18-7-4-8-20-13-6-5-11(10-16)9-12(13)17/h5-6,9H,4,7-8,17H2,1-3H3,(H,18,19) |
| InChIKey | HKIBMPOOVXXUPC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|