C16H21N2O7P — CID 22645206
tert-butyl N-[2-[5-cyano-2-[(E)-2-phosphonooxyethenyl]phenoxy]ethyl]carbamate (PubChem CID 22645206) has the molecular formula C16H21N2O7P and a molecular weight of 384.33 g/mol. Its IUPAC name is tert-butyl N-[2-[5-cyano-2-[(E)-2-phosphonooxyethenyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-cyano-2-[(E)-2-phosphonooxyethenyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 22645206 |
| Molecular Formula | C16H21N2O7P |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | tert-butyl N-[2-[5-cyano-2-[(E)-2-phosphonooxyethenyl]phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(C#N)ccc1/C=C/OP(=O)(O)O |
| InChI | InChI=1S/C16H21N2O7P/c1-16(2,3)25-15(19)18-7-9-23-14-10-12(11-17)4-5-13(14)6-8-24-26(20,21)22/h4-6,8,10H,7,9H2,1-3H3,(H,18,19)(H2,20,21,22)/b8-6+ |
| InChIKey | LJUHYWZVCRMUQC-SOFGYWHQSA-N |
| XLogP | 2.54 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|