C14H16N4O2 — CID 118213920
tert-butyl N-[(6-cyano-1H-benzimidazol-2-yl)methyl]carbamate (PubChem CID 118213920) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is tert-butyl N-[(6-cyano-1H-benzimidazol-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6-cyano-1H-benzimidazol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 118213920 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | tert-butyl N-[(6-cyano-1H-benzimidazol-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc2ccc(C#N)cc2[nH]1 |
| InChI | InChI=1S/C14H16N4O2/c1-14(2,3)20-13(19)16-8-12-17-10-5-4-9(7-15)6-11(10)18-12/h4-6H,8H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | NYAPRRUUDFBKAQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |