C25H34N4O3 — CID 155390029
tert-butyl N-[[6-[[2-(2-adamantyl)acetyl]amino]-1H-benzimidazol-2-yl]methyl]carbamate (PubChem CID 155390029) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is tert-butyl N-[[6-[[2-(2-adamantyl)acetyl]amino]-1H-benzimidazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-[[2-(2-adamantyl)acetyl]amino]-1H-benzimidazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 155390029 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | tert-butyl N-[[6-[[2-(2-adamantyl)acetyl]amino]-1H-benzimidazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc2ccc(NC(=O)CC3C4CC5CC(C4)CC3C5)cc2[nH]1 |
| InChI | InChI=1S/C25H34N4O3/c1-25(2,3)32-24(31)26-13-22-28-20-5-4-18(11-21(20)29-22)27-23(30)12-19-16-7-14-6-15(9-16)10-17(19)8-14/h4-5,11,14-17,19H,6-10,12-13H2,1-3H3,(H,26,31)(H,27,30)(H,28,29) |
| InChIKey | DDMTZCVTZUNHJP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |