C25H36ClN3O2Si — CID 155738298
2-(2-adamantyl)-N-[2-chloro-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]acetamide (PubChem CID 155738298) has the molecular formula C25H36ClN3O2Si and a molecular weight of 474.12 g/mol. Its IUPAC name is 2-(2-adamantyl)-N-[2-chloro-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]acetamide.
| Compound Name | 2-(2-adamantyl)-N-[2-chloro-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 155738298 |
| Molecular Formula | C25H36ClN3O2Si |
| Molecular Weight | 474.12 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-(2-adamantyl)-N-[2-chloro-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]acetamide |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)nc2ccc(NC(=O)CC3C4CC5CC(C4)CC3C5)cc21 |
| InChI | InChI=1S/C25H36ClN3O2Si/c1-32(2,3)7-6-31-15-29-23-13-20(4-5-22(23)28-25(29)26)27-24(30)14-21-18-9-16-8-17(11-18)12-19(21)10-16/h4-5,13,16-19,21H,6-12,14-15H2,1-3H3,(H,27,30) |
| InChIKey | KLBWCWXNPDGJTP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.12 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|