C23H27N5O4Si — CID 140703850
N-(4-isocyanophenyl)-3-[6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]propanamide (PubChem CID 140703850) has the molecular formula C23H27N5O4Si and a molecular weight of 465.59 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-3-[6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]propanamide.
| Compound Name | N-(4-isocyanophenyl)-3-[6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 140703850 |
| Molecular Formula | C23H27N5O4Si |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(4-isocyanophenyl)-3-[6-nitro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]propanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)CCc2nc3ccc([N+](=O)[O-])cc3n2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C23H27N5O4Si/c1-24-17-5-7-18(8-6-17)25-23(29)12-11-22-26-20-10-9-19(28(30)31)15-21(20)27(22)16-32-13-14-33(2,3)4/h5-10,15H,11-14,16H2,2-4H3,(H,25,29) |
| InChIKey | JWXJMSGPSVUNHI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|