C30H33ClN2O5Si — CID 67397282
1-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxycyclobutane-1-carboxylic acid (PubChem CID 67397282) has the molecular formula C30H33ClN2O5Si and a molecular weight of 565.14 g/mol. Its IUPAC name is 1-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 67397282 |
| Molecular Formula | C30H33ClN2O5Si |
| Molecular Weight | 565.14 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 1-[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxycyclobutane-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(OC2(C(=O)O)CCC2)nc2cc(-c3ccc(-c4ccccc4O)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C30H33ClN2O5Si/c1-39(2,3)16-15-37-19-33-26-18-24(31)23(17-25(26)32-29(33)38-30(28(35)36)13-6-14-30)21-11-9-20(10-12-21)22-7-4-5-8-27(22)34/h4-5,7-12,17-18,34H,6,13-16,19H2,1-3H3,(H,35,36) |
| InChIKey | QGWUHMXATKKUPL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.14 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|