C32H35ClFN3O5Si — CID 68659495
methyl 5-[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate (PubChem CID 68659495) has the molecular formula C32H35ClFN3O5Si and a molecular weight of 624.19 g/mol. Its IUPAC name is methyl 5-[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate.
| Compound Name | methyl 5-[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate |
|---|---|
| PubChem CID | 68659495 |
| Molecular Formula | C32H35ClFN3O5Si |
| Molecular Weight | 624.19 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | methyl 5-[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate |
| SMILES | COC(=O)c1cc(Oc2nc3cc(-c4cc5ccn(CCO)c5cc4F)c(Cl)cc3n2COCC[Si](C)(C)C)ccc1C |
| InChI | InChI=1S/C32H35ClFN3O5Si/c1-20-6-7-22(15-23(20)31(39)40-2)42-32-35-28-16-24(25-14-21-8-9-36(10-11-38)29(21)18-27(25)34)26(33)17-30(28)37(32)19-41-12-13-43(3,4)5/h6-9,14-18,38H,10-13,19H2,1-5H3 |
| InChIKey | FIHQLQGXBUDGNM-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.19 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|