C31H34ClN3O4Si — CID 68573088
methyl 5-[6-chloro-5-(1-methylindol-5-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate (PubChem CID 68573088) has the molecular formula C31H34ClN3O4Si and a molecular weight of 576.17 g/mol. Its IUPAC name is methyl 5-[6-chloro-5-(1-methylindol-5-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate.
| Compound Name | methyl 5-[6-chloro-5-(1-methylindol-5-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate |
|---|---|
| PubChem CID | 68573088 |
| Molecular Formula | C31H34ClN3O4Si |
| Molecular Weight | 576.17 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | methyl 5-[6-chloro-5-(1-methylindol-5-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]oxy-2-methylbenzoate |
| SMILES | COC(=O)c1cc(Oc2nc3cc(-c4ccc5c(ccn5C)c4)c(Cl)cc3n2COCC[Si](C)(C)C)ccc1C |
| InChI | InChI=1S/C31H34ClN3O4Si/c1-20-7-9-23(16-24(20)30(36)37-3)39-31-33-27-17-25(21-8-10-28-22(15-21)11-12-34(28)2)26(32)18-29(27)35(31)19-38-13-14-40(4,5)6/h7-12,15-18H,13-14,19H2,1-6H3 |
| InChIKey | GIZFQVRFBKCTAV-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.17 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|