C31H31ClFN3O5SSi — CID 165391816
methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-chloro-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate (PubChem CID 165391816) has the molecular formula C31H31ClFN3O5SSi and a molecular weight of 640.21 g/mol. Its IUPAC name is methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-chloro-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate.
| Compound Name | methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-chloro-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 165391816 |
| Molecular Formula | C31H31ClFN3O5SSi |
| Molecular Weight | 640.21 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | methyl 5-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-2-(2-chloro-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccnc3c2ccn3S(=O)(=O)c2ccccc2)n(COCC[Si](C)(C)C)c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C31H31ClFN3O5SSi/c1-40-31(37)26-19-28(35(20-41-16-17-43(2,3)4)29(26)25-11-10-21(33)18-27(25)32)23-12-14-34-30-24(23)13-15-36(30)42(38,39)22-8-6-5-7-9-22/h5-15,18-19H,16-17,20H2,1-4H3 |
| InChIKey | OQYDEARVJVDBHA-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.21 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|