C30H27Cl2N3O5SSi — CID 165391794
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-8,9-dichloro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one (PubChem CID 165391794) has the molecular formula C30H27Cl2N3O5SSi and a molecular weight of 640.62 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-8,9-dichloro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-8,9-dichloro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 165391794 |
| Molecular Formula | C30H27Cl2N3O5SSi |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-4-yl]-8,9-dichloro-1-(2-trimethylsilylethoxymethyl)chromeno[4,3-b]pyrrol-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccnc3c2ccn3S(=O)(=O)c2ccccc2)cc2c(=O)oc3ccc(Cl)c(Cl)c3c21 |
| InChI | InChI=1S/C30H27Cl2N3O5SSi/c1-42(2,3)16-15-39-18-34-24(17-22-28(34)26-25(40-30(22)36)10-9-23(31)27(26)32)20-11-13-33-29-21(20)12-14-35(29)41(37,38)19-7-5-4-6-8-19/h4-14,17H,15-16,18H2,1-3H3 |
| InChIKey | GJWPEESIMCBROQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|