C23H25I2N3O3SSi — CID 176847181
2-[[2-[1-(benzenesulfonyl)indol-3-yl]-4,5-diiodoimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 176847181) has the molecular formula C23H25I2N3O3SSi and a molecular weight of 705.43 g/mol. Its IUPAC name is 2-[[2-[1-(benzenesulfonyl)indol-3-yl]-4,5-diiodoimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[1-(benzenesulfonyl)indol-3-yl]-4,5-diiodoimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 176847181 |
| Molecular Formula | C23H25I2N3O3SSi |
| Molecular Weight | 705.43 g/mol |
| Exact Mass | 704.95 |
| IUPAC Name | 2-[[2-[1-(benzenesulfonyl)indol-3-yl]-4,5-diiodoimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)nc(I)c1I |
| InChI | InChI=1S/C23H25I2N3O3SSi/c1-33(2,3)14-13-31-16-27-22(25)21(24)26-23(27)19-15-28(20-12-8-7-11-18(19)20)32(29,30)17-9-5-4-6-10-17/h4-12,15H,13-14,16H2,1-3H3 |
| InChIKey | RTOXXKTWUUYORB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|