C23H31NO3SSi — CID 11453175
tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy]silane (PubChem CID 11453175) has the molecular formula C23H31NO3SSi and a molecular weight of 429.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy]silane |
|---|---|
| PubChem CID | 11453175 |
| Molecular Formula | C23H31NO3SSi |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy]silane |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CCO[Si](C)(C)C(C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H31NO3SSi/c1-18-11-13-20(14-12-18)28(25,26)24-17-19(21-9-7-8-10-22(21)24)15-16-27-29(5,6)23(2,3)4/h7-14,17H,15-16H2,1-6H3 |
| InChIKey | FOLKOXLIMYLZQF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|