C31H35NO5S2Si — CID 162412592
2-[4-[2-(benzenesulfonyl)ethynyl]-1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 162412592) has the molecular formula C31H35NO5S2Si and a molecular weight of 593.84 g/mol. Its IUPAC name is 2-[4-[2-(benzenesulfonyl)ethynyl]-1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[4-[2-(benzenesulfonyl)ethynyl]-1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162412592 |
| Molecular Formula | C31H35NO5S2Si |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 2-[4-[2-(benzenesulfonyl)ethynyl]-1-(4-methylphenyl)sulfonylindol-3-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CCO[Si](C)(C)C(C)(C)C)c3c(C#CS(=O)(=O)c4ccccc4)cccc32)cc1 |
| InChI | InChI=1S/C31H35NO5S2Si/c1-24-15-17-28(18-16-24)39(35,36)32-23-26(19-21-37-40(5,6)31(2,3)4)30-25(11-10-14-29(30)32)20-22-38(33,34)27-12-8-7-9-13-27/h7-18,23H,19,21H2,1-6H3 |
| InChIKey | DWCNOSBDPGQOTM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|