C29H27NO7S — CID 176948839
2,2-dimethyl-5-[[1-(4-methylphenyl)sulfonyl-4-phenylmethoxyindol-3-yl]methyl]-1,3-dioxane-4,6-dione (PubChem CID 176948839) has the molecular formula C29H27NO7S and a molecular weight of 533.60 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[1-(4-methylphenyl)sulfonyl-4-phenylmethoxyindol-3-yl]methyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[1-(4-methylphenyl)sulfonyl-4-phenylmethoxyindol-3-yl]methyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 176948839 |
| Molecular Formula | C29H27NO7S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2,2-dimethyl-5-[[1-(4-methylphenyl)sulfonyl-4-phenylmethoxyindol-3-yl]methyl]-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CC3C(=O)OC(C)(C)OC3=O)c3c(OCc4ccccc4)cccc32)cc1 |
| InChI | InChI=1S/C29H27NO7S/c1-19-12-14-22(15-13-19)38(33,34)30-17-21(16-23-27(31)36-29(2,3)37-28(23)32)26-24(30)10-7-11-25(26)35-18-20-8-5-4-6-9-20/h4-15,17,23H,16,18H2,1-3H3 |
| InChIKey | MMXYLCDMSVCLSB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|