C28H27N3O5S — CID 87356866
benzyl 4-[3-formyl-1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate (PubChem CID 87356866) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is benzyl 4-[3-formyl-1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[3-formyl-1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87356866 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | benzyl 4-[3-formyl-1-(4-methylphenyl)sulfonylindol-4-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C=O)c3c(N4CCN(C(=O)OCc5ccccc5)CC4)cccc32)cc1 |
| InChI | InChI=1S/C28H27N3O5S/c1-21-10-12-24(13-11-21)37(34,35)31-18-23(19-32)27-25(8-5-9-26(27)31)29-14-16-30(17-15-29)28(33)36-20-22-6-3-2-4-7-22/h2-13,18-19H,14-17,20H2,1H3 |
| InChIKey | RVROOTKGAUIACQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|