C27H27NO3 — CID 129187791
benzyl 6-formyl-5,8-dimethyl-7-(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 129187791) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is benzyl 6-formyl-5,8-dimethyl-7-(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 6-formyl-5,8-dimethyl-7-(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 129187791 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | benzyl 6-formyl-5,8-dimethyl-7-(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | Cc1ccc(-c2c(C)c3c(c(C)c2C=O)CCN(C(=O)OCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-18-9-11-22(12-10-18)26-20(3)24-15-28(14-13-23(24)19(2)25(26)16-29)27(30)31-17-21-7-5-4-6-8-21/h4-12,16H,13-15,17H2,1-3H3 |
| InChIKey | LQAGHAJJWFWHPZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|