C26H26N2O2 — CID 11003857
benzyl 5,6,11-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]carbazole-2-carboxylate (PubChem CID 11003857) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is benzyl 5,6,11-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]carbazole-2-carboxylate.
| Compound Name | benzyl 5,6,11-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 11003857 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | benzyl 5,6,11-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
| SMILES | Cc1c2c(c(C)c3c1c1ccccc1n3C)CCN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C26H26N2O2/c1-17-22-15-28(26(29)30-16-19-9-5-4-6-10-19)14-13-20(22)18(2)25-24(17)21-11-7-8-12-23(21)27(25)3/h4-12H,13-16H2,1-3H3 |
| InChIKey | LDWVODZOGSJMEA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|