C24H26N2O2 — CID 12051610
benzyl 11-methyl-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate (PubChem CID 12051610) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl 11-methyl-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate.
| Compound Name | benzyl 11-methyl-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 12051610 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | benzyl 11-methyl-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate |
| SMILES | Cc1cc2c3c(c1)c1c(n3CCC2)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O2/c1-17-14-19-8-5-11-26-22-10-13-25(12-9-20(22)21(15-17)23(19)26)24(27)28-16-18-6-3-2-4-7-18/h2-4,6-7,14-15H,5,8-13,16H2,1H3 |
| InChIKey | UIVARLKPWVMWCZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|