C23H21F3N2O3 — CID 10274280
benzyl 10-(trifluoromethyl)-14-oxa-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate (PubChem CID 10274280) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is benzyl 10-(trifluoromethyl)-14-oxa-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate.
| Compound Name | benzyl 10-(trifluoromethyl)-14-oxa-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 10274280 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | benzyl 10-(trifluoromethyl)-14-oxa-1,5-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraene-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2c(n3c4c(ccc(C(F)(F)F)c24)OCC3)CC1 |
| InChI | InChI=1S/C23H21F3N2O3/c24-23(25,26)17-6-7-19-21-20(17)16-8-10-27(11-9-18(16)28(21)12-13-30-19)22(29)31-14-15-4-2-1-3-5-15/h1-7H,8-14H2 |
| InChIKey | SJGLQZGXWNTCGF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |