C18H18ClNO3 — CID 165474017
benzyl 8-(chloromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (PubChem CID 165474017) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is benzyl 8-(chloromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
| Compound Name | benzyl 8-(chloromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
|---|---|
| PubChem CID | 165474017 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | benzyl 8-(chloromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCOc2cc(CCl)ccc2C1 |
| InChI | InChI=1S/C18H18ClNO3/c19-11-15-6-7-16-12-20(8-9-22-17(16)10-15)18(21)23-13-14-4-2-1-3-5-14/h1-7,10H,8-9,11-13H2 |
| InChIKey | YZBCTPAHOSFTJU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|