benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate

C16H14BrNO3 — CID 133060509

IUPACbenzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate
SMILESO=C(OCc1ccccc1)N1CCOc2cc(Br)ccc21
InChIInChI=1S/C16H14BrNO3/c17-13-6-7-14-15(10-13)20-9-8-18(14)16(19)21-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2
InChIKeyONQMVCXFZQUADR-UHFFFAOYSA-N
MW348.20 g/mol
LogP3.98
Rot. Bonds2

About benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate

benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 133060509) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate.

Molecular Properties

Compound Namebenzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate
PubChem CID133060509
Molecular FormulaC16H14BrNO3
Molecular Weight348.20 g/mol
Exact Mass347.02
IUPAC Namebenzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate
SMILESO=C(OCc1ccccc1)N1CCOc2cc(Br)ccc21
InChIInChI=1S/C16H14BrNO3/c17-13-6-7-14-15(10-13)20-9-8-18(14)16(19)21-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2
InChIKeyONQMVCXFZQUADR-UHFFFAOYSA-N
XLogP3.98
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.20
LogP ≤ 53.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The IUPAC name of benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate (CID 133060509) is benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
What is the SMILES notation for benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The canonical SMILES for benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate is O=C(OCc1ccccc1)N1CCOc2cc(Br)ccc21.
What is the InChIKey of benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The InChIKey is ONQMVCXFZQUADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO3/c17-13-6-7-14-15(10-13)20-9-8-18(14)16(19)21-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2.
What are the key properties of benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate has a molecular weight of 348.20 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 7-bromo-2,3-dihydro-1,4-benzoxazine-4-carboxylate is sourced from PubChem (CID 133060509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).