C15H14N2O3 — CID 176887420
benzyl 2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (PubChem CID 176887420) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is benzyl 2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate.
| Compound Name | benzyl 2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 176887420 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | benzyl 2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCOc2ncccc21 |
| InChI | InChI=1S/C15H14N2O3/c18-15(20-11-12-5-2-1-3-6-12)17-9-10-19-14-13(17)7-4-8-16-14/h1-8H,9-11H2 |
| InChIKey | RSQFYARVZGADTH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |