C17H16BrNO4 — CID 69056945
benzyl 8-bromo-6-methoxy-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 69056945) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is benzyl 8-bromo-6-methoxy-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
| Compound Name | benzyl 8-bromo-6-methoxy-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
|---|---|
| PubChem CID | 69056945 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | benzyl 8-bromo-6-methoxy-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| SMILES | COc1cc(Br)c2c(c1)N(C(=O)OCc1ccccc1)CCO2 |
| InChI | InChI=1S/C17H16BrNO4/c1-21-13-9-14(18)16-15(10-13)19(7-8-22-16)17(20)23-11-12-5-3-2-4-6-12/h2-6,9-10H,7-8,11H2,1H3 |
| InChIKey | JJKRMBLXUMOOAP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |