C20H19NO6 — CID 18638958
[(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 18638958) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 18638958 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(2S)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl] 2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cc1ccccc1)OC(=O)N1CCOC1=O |
| InChI | InChI=1S/C20H19NO6/c22-18(26-14-16-9-5-2-6-10-16)17(13-15-7-3-1-4-8-15)27-20(24)21-11-12-25-19(21)23/h1-10,17H,11-14H2/t17-/m0/s1 |
| InChIKey | SDMRNVLEZOYWAB-KRWDZBQOSA-N |
| XLogP | 2.93 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|