C32H29NO7 — CID 134943425
dibenzyl 2-[(2S)-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-5-phenylpent-4-ynyl]propanedioate (PubChem CID 134943425) has the molecular formula C32H29NO7 and a molecular weight of 539.58 g/mol. Its IUPAC name is dibenzyl 2-[(2S)-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-5-phenylpent-4-ynyl]propanedioate.
| Compound Name | dibenzyl 2-[(2S)-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-5-phenylpent-4-ynyl]propanedioate |
|---|---|
| PubChem CID | 134943425 |
| Molecular Formula | C32H29NO7 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | dibenzyl 2-[(2S)-2-(2-oxo-1,3-oxazolidine-3-carbonyl)-5-phenylpent-4-ynyl]propanedioate |
| SMILES | O=C(OCc1ccccc1)C(C[C@@H](CC#Cc1ccccc1)C(=O)N1CCOC1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H29NO7/c34-29(33-19-20-38-32(33)37)27(18-10-17-24-11-4-1-5-12-24)21-28(30(35)39-22-25-13-6-2-7-14-25)31(36)40-23-26-15-8-3-9-16-26/h1-9,11-16,27-28H,18-23H2/t27-/m1/s1 |
| InChIKey | ZFYXDGVIZYFGHC-HHHXNRCGSA-N |
| XLogP | 4.52 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|