C21H29NO4Si — CID 10596397
3-[(2R,3R)-2-methyl-3-[(1S)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-1,3-oxazolidin-2-one (PubChem CID 10596397) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-[(2R,3R)-2-methyl-3-[(1S)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R,3R)-2-methyl-3-[(1S)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10596397 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[(2R,3R)-2-methyl-3-[(1S)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](C#C[Si](C)(C)C)[C@@H](C)C(=O)N1CCOC1=O |
| InChI | InChI=1S/C21H29NO4Si/c1-16(20(23)22-12-13-25-21(22)24)19(11-14-27(3,4)5)17(2)26-15-18-9-7-6-8-10-18/h6-10,16-17,19H,12-13,15H2,1-5H3/t16-,17+,19+/m1/s1 |
| InChIKey | CPVKIRKTVOAMNH-AOIWGVFYSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|