C16H24O2Si — CID 10540448
[(4S)-3-methoxy-4-phenylmethoxypent-1-ynyl]-trimethylsilane (PubChem CID 10540448) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is [(4S)-3-methoxy-4-phenylmethoxypent-1-ynyl]-trimethylsilane.
| Compound Name | [(4S)-3-methoxy-4-phenylmethoxypent-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10540448 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(4S)-3-methoxy-4-phenylmethoxypent-1-ynyl]-trimethylsilane |
| SMILES | COC(C#C[Si](C)(C)C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C16H24O2Si/c1-14(16(17-2)11-12-19(3,4)5)18-13-15-9-7-6-8-10-15/h6-10,14,16H,13H2,1-5H3/t14-,16?/m0/s1 |
| InChIKey | MACQEKQEQPHPPM-LBAUFKAWSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|