C32H38O4Si — CID 102210980
(3R,4S,5S,6S)-4,5,6-tris(phenylmethoxy)-1-trimethylsilyloct-7-en-1-yn-3-ol (PubChem CID 102210980) has the molecular formula C32H38O4Si and a molecular weight of 514.74 g/mol. Its IUPAC name is (3R,4S,5S,6S)-4,5,6-tris(phenylmethoxy)-1-trimethylsilyloct-7-en-1-yn-3-ol.
| Compound Name | (3R,4S,5S,6S)-4,5,6-tris(phenylmethoxy)-1-trimethylsilyloct-7-en-1-yn-3-ol |
|---|---|
| PubChem CID | 102210980 |
| Molecular Formula | C32H38O4Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (3R,4S,5S,6S)-4,5,6-tris(phenylmethoxy)-1-trimethylsilyloct-7-en-1-yn-3-ol |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C32H38O4Si/c1-5-30(34-23-26-15-9-6-10-16-26)32(36-25-28-19-13-8-14-20-28)31(29(33)21-22-37(2,3)4)35-24-27-17-11-7-12-18-27/h5-20,29-33H,1,23-25H2,2-4H3/t29-,30+,31+,32+/m1/s1 |
| InChIKey | DCEQKXRAJDBCGN-ZLESDFJESA-N |
| XLogP | 6.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|