C25H30O5 — CID 11560592
ethyl (2S,3R,4S,5S)-2-ethenyl-3-hydroxy-4,5-bis(phenylmethoxy)hept-6-enoate (PubChem CID 11560592) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-2-ethenyl-3-hydroxy-4,5-bis(phenylmethoxy)hept-6-enoate.
| Compound Name | ethyl (2S,3R,4S,5S)-2-ethenyl-3-hydroxy-4,5-bis(phenylmethoxy)hept-6-enoate |
|---|---|
| PubChem CID | 11560592 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-2-ethenyl-3-hydroxy-4,5-bis(phenylmethoxy)hept-6-enoate |
| SMILES | C=C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)[C@H](C=C)C(=O)OCC |
| InChI | InChI=1S/C25H30O5/c1-4-21(25(27)28-6-3)23(26)24(30-18-20-15-11-8-12-16-20)22(5-2)29-17-19-13-9-7-10-14-19/h4-5,7-16,21-24,26H,1-2,6,17-18H2,3H3/t21-,22-,23+,24+/m0/s1 |
| InChIKey | ZGLYIDVVHIGIGO-CJRSTVEYSA-N |
| XLogP | 4.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|