C24H38O5Si — CID 102125508
ethyl (2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-hydroxy-4-phenylmethoxyhept-6-enoate (PubChem CID 102125508) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is ethyl (2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-hydroxy-4-phenylmethoxyhept-6-enoate.
| Compound Name | ethyl (2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-hydroxy-4-phenylmethoxyhept-6-enoate |
|---|---|
| PubChem CID | 102125508 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | ethyl (2S,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-hydroxy-4-phenylmethoxyhept-6-enoate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](OCc1ccccc1)[C@H](O)[C@H](C=C)C(=O)OCC |
| InChI | InChI=1S/C24H38O5Si/c1-9-19(23(26)27-11-3)21(25)22(28-17-18-15-13-12-14-16-18)20(10-2)29-30(7,8)24(4,5)6/h9-10,12-16,19-22,25H,1-2,11,17H2,3-8H3/t19-,20-,21+,22-/m0/s1 |
| InChIKey | KWLJKNIIZIWPRQ-KJJMTIBFSA-N |
| XLogP | 4.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|