C32H45NO6Si — CID 11365094
(4R)-4-benzyl-3-[(2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methyl-2-phenylmethoxyoct-7-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11365094) has the molecular formula C32H45NO6Si and a molecular weight of 567.80 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methyl-2-phenylmethoxyoct-7-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methyl-2-phenylmethoxyoct-7-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11365094 |
| Molecular Formula | C32H45NO6Si |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (4R)-4-benzyl-3-[(2S,3R,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methyl-2-phenylmethoxyoct-7-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)[C@H](OCc1ccccc1)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H45NO6Si/c1-8-15-27(39-40(6,7)32(3,4)5)23(2)28(34)29(37-21-25-18-13-10-14-19-25)30(35)33-26(22-38-31(33)36)20-24-16-11-9-12-17-24/h8-14,16-19,23,26-29,34H,1,15,20-22H2,2-7H3/t23-,26-,27+,28-,29+/m1/s1 |
| InChIKey | QLDMGKVHQQOUHJ-GYDNBQAISA-N |
| XLogP | 6.13 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|