C31H43NO6Si — CID 156665880
(4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-[(4-methoxyphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one (PubChem CID 156665880) has the molecular formula C31H43NO6Si and a molecular weight of 553.77 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-[(4-methoxyphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-[(4-methoxyphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 156665880 |
| Molecular Formula | C31H43NO6Si |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-[(4-methoxyphenyl)methoxy]pentanoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@H](CCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H43NO6Si/c1-8-27(29(33)32-25(22-37-30(32)34)20-23-12-10-9-11-13-23)28(38-39(6,7)31(2,3)4)18-19-36-21-24-14-16-26(35-5)17-15-24/h8-17,25,27-28H,1,18-22H2,2-7H3/t25-,27-,28+/m1/s1 |
| InChIKey | WGBLLDUAMBXREV-KZQOYIJHSA-N |
| XLogP | 6.38 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|