C14H16ClNO4 — CID 139669353
(4S)-3-(2-chloropropanoyl)-4-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 139669353) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is (4S)-3-(2-chloropropanoyl)-4-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(2-chloropropanoyl)-4-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139669353 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (4S)-3-(2-chloropropanoyl)-4-[(4-methoxyphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C[C@H]2COC(=O)N2C(=O)C(C)Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO4/c1-9(15)13(17)16-11(8-20-14(16)18)7-10-3-5-12(19-2)6-4-10/h3-6,9,11H,7-8H2,1-2H3/t9?,11-/m0/s1 |
| InChIKey | FMJWHMCUQRJOHS-UMJHXOGRSA-N |
| XLogP | 2.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|