C10H16ClNO3 — CID 139669354
(4S)-3-(2-chloropropanoyl)-4-(2-methylpropyl)-1,3-oxazolidin-2-one (PubChem CID 139669354) has the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. Its IUPAC name is (4S)-3-(2-chloropropanoyl)-4-(2-methylpropyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(2-chloropropanoyl)-4-(2-methylpropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139669354 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (4S)-3-(2-chloropropanoyl)-4-(2-methylpropyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)C[C@H]1COC(=O)N1C(=O)C(C)Cl |
| InChI | InChI=1S/C10H16ClNO3/c1-6(2)4-8-5-15-10(14)12(8)9(13)7(3)11/h6-8H,4-5H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | PILOSLWIGUJASV-MQWKRIRWSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|