C19H22ClNO3 — CID 11221759
(4R)-4-benzyl-3-[(2R,5E,7E)-8-chloro-2-methylocta-5,7-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 11221759) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,5E,7E)-8-chloro-2-methylocta-5,7-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,5E,7E)-8-chloro-2-methylocta-5,7-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11221759 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,5E,7E)-8-chloro-2-methylocta-5,7-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CC/C=C/C=C/Cl)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-15(9-5-2-3-8-12-20)18(22)21-17(14-24-19(21)23)13-16-10-6-4-7-11-16/h2-4,6-8,10-12,15,17H,5,9,13-14H2,1H3/b3-2+,12-8+/t15-,17-/m1/s1 |
| InChIKey | FATXCFPQJLBRFY-OABIVBHESA-N |
| XLogP | 4.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|